![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | abstract module.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | access.html | 2010-05-31 08:11 | 23K | |
![[TXT]](/icons/text.gif) | access control.html | 2010-05-31 08:11 | 12K | |
![[TXT]](/icons/text.gif) | access control information.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | accessibility.html | 2010-05-31 08:11 | 14K | |
![[TXT]](/icons/text.gif) | accessibility information.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | accessibility problem.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | accessible.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | accessible authoring practice.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | access mechanism.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | access rights.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | acquired infoset.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | activate.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | active grammar.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | active perceivable unit.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | activity.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | actor.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | adaptation.html | 2010-05-31 08:11 | 13K | |
![[TXT]](/icons/text.gif) | adaptation preferences.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | additional characters.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | advisory board.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | advisory committee.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | age-2.html | 2010-05-31 08:11 | 27K | |
![[TXT]](/icons/text.gif) | age-4.html | 2010-05-31 08:11 | 27K | |
![[TXT]](/icons/text.gif) | age-6.html | 2010-05-31 08:11 | 28K | |
![[TXT]](/icons/text.gif) | age.html | 2010-05-31 08:11 | 26K | |
![[TXT]](/icons/text.gif) | agent.html | 2010-05-31 08:11 | 23K | |
![[TXT]](/icons/text.gif) | aggregated authored units.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | aggregation.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | alert.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | alias.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | alpha.html | 2010-05-31 08:11 | 16K | |
![[TXT]](/icons/text.gif) | alpha compaction.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | alpha separation.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | alpha table.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | alternative information.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | amaya.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | ancestor.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | anchor.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | ancillary chunk.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | animation.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | annotation.html | 2010-05-31 08:11 | 12K | |
![[TXT]](/icons/text.gif) | anonymity.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | anonymous type name.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | antecedent.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | apache.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | applet.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | application.html | 2010-05-31 08:11 | 18K | |
![[TXT]](/icons/text.gif) | application personalization.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | arc.html | 2010-05-31 08:11 | 17K | |
![[TXT]](/icons/text.gif) | architecture.html | 2010-05-31 08:11 | 15K | |
![[TXT]](/icons/text.gif) | argument.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | arity.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | artifact.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | assertion.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | assistive technology.html | 2010-05-31 08:11 | 13K | |
![[TXT]](/icons/text.gif) | asynchronous.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | asynchronous exchange.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | atomic.html | 2010-05-31 08:11 | 13K | |
![[TXT]](/icons/text.gif) | atomic test.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | atomic type.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | atomic value.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | atomization.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | attribute-2.html | 2010-05-31 08:11 | 18K | |
![[TXT]](/icons/text.gif) | attribute-list declarations.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | attribute.html | 2010-05-31 08:11 | 23K | |
![[TXT]](/icons/text.gif) | attribute name.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | attribute set.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | attribute specifications.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | attribute value.html | 2010-05-31 08:11 | 15K | |
![[TXT]](/icons/text.gif) | attribute value template.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | at user option.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | audio-only presentation.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | audio.html | 2010-05-31 08:11 | 15K | |
![[TXT]](/icons/text.gif) | audio description.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | audio track.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | audit guard.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | auditory description.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | authentication.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | author.html | 2010-05-31 08:11 | 22K | |
![[TXT]](/icons/text.gif) | authored unit.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | authoring.html | 2010-05-31 08:11 | 18K | |
![[TXT]](/icons/text.gif) | authoring tool.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | authorization.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | author styles.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | available collections..html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | available documents..html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | axis.html | 2010-05-31 08:11 | 12K | |
![[TXT]](/icons/text.gif) | axis step.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | background image interference.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | back link.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | backward compatible.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | backwards compatibility feature.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | base URI..html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | base URI declaration.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | baseline.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | base output URI.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | base text.html | 2010-05-31 08:11 | 9.6K | |
![[TXT]](/icons/text.gif) | basic XSLT processor.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | basic readability:.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | binding.html | 2010-05-31 08:11 | 18K | |
![[TXT]](/icons/text.gif) | binding expression.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | binding sequence.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | bit depth.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | black box.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | bopomofo.html | 2010-05-31 08:11 | 9.6K | |
![[TXT]](/icons/text.gif) | bot.html | 2010-05-31 08:11 | 9.6K | |
![[TXT]](/icons/text.gif) | boundary-space declaration.html | 2010-05-31 08:11 | 9.9K | |
![[TXT]](/icons/text.gif) | boundary-space policy..html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | boundary whitespace.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | bounding box.html | 2010-05-31 08:11 | 9.8K | |
![[TXT]](/icons/text.gif) | box.html | 2010-05-31 08:11 | 12K | |
![[TXT]](/icons/text.gif) | braille.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | bridge.html | 2010-05-31 08:11 | 9.6K | |
![[TXT]](/icons/text.gif) | browser.html | 2010-05-31 08:11 | 14K | |
![[TXT]](/icons/text.gif) | built-in functions.html | 2010-05-31 08:11 | 10K | |
![[TXT]](/icons/text.gif) | button.html | 2010-05-31 08:11 | 9.7K | |
![[TXT]](/icons/text.gif) | byte.html | 2010-05-31 08:11 | 14K | |
![[TXT]](/icons/text.gif) | byte order.html | 2010-05-31 08:11 | 11K | |
![[TXT]](/icons/text.gif) | cache.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | cacheable.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | capability.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | captions.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | card.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | cascading style sheets (CSS).html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | catch element.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | certification.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | chair.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | chairman.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | channel.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | character.html | 2010-05-31 08:12 | 24K | |
![[TXT]](/icons/text.gif) | character data (CDATA).html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | character data.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | character encoding.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | character map.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | character or expression depth.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | character or expression height.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | character or expression width.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | character reference.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | check for.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | child.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | choreography.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | chromaticity (CIE).html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | chunk.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | circularity.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | class.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | class definition.html | 2010-05-31 08:12 | 9.6K | |
![[TXT]](/icons/text.gif) | class description.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | class name.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | class of products.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | click-stream.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | client.html | 2010-05-31 08:12 | 16K | |
![[TXT]](/icons/text.gif) | collapse.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | collated text transcript.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | collation.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | colour type.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | comm.html | 2010-05-31 08:12 | 19K | |
![[TXT]](/icons/text.gif) | comma operator.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | comments.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | complete.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | complex ruby markup.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | compliance.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | component.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | composite (verb).html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | computed element constructor.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | computed expression.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | concept.html | 2010-05-31 08:12 | 9.6K | |
![[TXT]](/icons/text.gif) | condition.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | conditional content.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | conditional sections.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | confidentiality.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | configuration.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | configure, control.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | conformance.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | conformance clause.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | conformance testing.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | conforming document.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | connection.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | consequent.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | consistent.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | constraint.html | 2010-05-31 08:12 | 16K | |
![[TXT]](/icons/text.gif) | constraint onstraint .html | 2010-05-31 08:12 | 16K | |
![[TXT]](/icons/text.gif) | construction declaration.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | construction mode..html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | constructor function.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | contained (element A is contained ined .html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | container (Constructor).html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | containing document.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | content-2.html | 2010-05-31 08:12 | 31K | |
![[TXT]](/icons/text.gif) | content-4.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | content.html | 2010-05-31 08:12 | 28K | |
![[TXT]](/icons/text.gif) | content developer.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | content elements.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | content expression.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | content generation.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | content model.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | content negotiation.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | content provider.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | content selection.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | content set.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | content token element.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | context (of a given mathML expression).html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | context item.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | context item static type..html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | context node.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | context position.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | context size.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | control.html | 2010-05-31 08:12 | 20K | |
![[TXT]](/icons/text.gif) | control item.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | convenience.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | conversation.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | conversion tool.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | cookie.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | copy-namespaces declaration.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | copy-namespaces mode..html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | core function.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | correct.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | credentials.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | critical chunk.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | current captured substrings.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | current dateTime..html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | current group.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | current grouping key.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | current mode.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | current template rule.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | cyberspace.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | cyc.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | dTD-determined ID.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | daemon.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | data-valued property.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | database.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | data category.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | data element.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | data model.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | data model schema.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | data resource.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | data schema.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | data set.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | datastream.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | data structure.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | datatype.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | datatype property.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | date formatting functions.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | date space.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | decideable.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | decimal format.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | declaration-2.html | 2010-05-31 08:12 | 21K | |
![[TXT]](/icons/text.gif) | declaration.html | 2010-05-31 08:12 | 24K | |
![[TXT]](/icons/text.gif) | declaration order.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | declarations.html | 2010-05-31 08:12 | 16K | |
![[TXT]](/icons/text.gif) | declared.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | decomposition.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | deepest.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | default-2.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | default.html | 2010-05-31 08:12 | 24K | |
![[TXT]](/icons/text.gif) | default collation..html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | default collation.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | default collation declaration.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | default collection..html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | default function namespace..html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | default mode.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | default namespace.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | default order for empty sequences..html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | default priority.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | deferred request authentication.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | defining element.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | defining required attributes.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | defining the type of attribute values.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | deflate.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | delivered image.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | delivery context.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | delivery policy.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | delivery unit.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | depends.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | deprecated.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | deprecated feature.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | depth.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | dereference a URI.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | descendant.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | descendants.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | device-independence.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | device.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | device independent.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | dialog.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | digital rights management.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | digital signature.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | dimensions of variability (DoV).html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | direct element constructor.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | directly contained (element A ined .html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | directly depends.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | director.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | direct sub-expression (of a mathML expression(of .html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | discovery.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | discovery service.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | discretionary item.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | document-2.html | 2010-05-31 08:12 | 26K | |
![[TXT]](/icons/text.gif) | document-4.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | document.html | 2010-05-31 08:12 | 26K | |
![[TXT]](/icons/text.gif) | documentation.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | document character set.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | document content, structure, and presentation.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | document entity.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | document language.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | document model.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | document object, document.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | document object model.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | document order.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | document profile.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | document source, text source, .html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | document style semantics and specification language (DSSSL).html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | document tree.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | document type.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | document type declaration.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | document type definition (DTD).html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | domain.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | domain name.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | driver.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | dublin core.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | dynamic HTML (DHTML).html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | dynamic content.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | dynamic context.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | dynamic error.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | dynamic evaluation phase.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | dynamic type.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | eCMAScript.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | early normalization.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | ease of parsing and serializing:.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | editing view.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | effective boolean value.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | effective case.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | effective value.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | electronic data interchange (EDI).html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | element, element type.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | element-2.html | 2010-05-31 08:12 | 25K | |
![[TXT]](/icons/text.gif) | element-4.html | 2010-05-31 08:12 | 17K | |
![[TXT]](/icons/text.gif) | element.html | 2010-05-31 08:12 | 24K | |
![[TXT]](/icons/text.gif) | element content.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | element name.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | elements.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | element type.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | element type declaration.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | embed.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | embedded object.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | embedded stylesheet module.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | embellished operator.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | empty-element tag.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | empty.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | empty order declaration.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | empty sequence.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | enabled element, disabled element, .html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | encoding declaration.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | encryption.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | end-tag.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | ending resource.html | 2010-05-31 08:12 | 9.6K | |
![[TXT]](/icons/text.gif) | end point.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | enquire.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | entail.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | entities.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | entity-2.html | 2010-05-31 08:12 | 18K | |
![[TXT]](/icons/text.gif) | entity.html | 2010-05-31 08:12 | 23K | |
![[TXT]](/icons/text.gif) | entity reference.html | 2010-05-31 08:12 | 15K | |
![[TXT]](/icons/text.gif) | enumerated attributes.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | episode.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | equable practice.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | equivalent (for content).html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | equivalent.html | 2010-05-31 08:12 | 16K | |
![[TXT]](/icons/text.gif) | error-2.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | error.html | 2010-05-31 08:12 | 23K | |
![[TXT]](/icons/text.gif) | error correction.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | error recovery.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | error values.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | escape.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | event.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | events and scripting, event handler, eventhandler, .html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | executable content.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | expanded-QName.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | expanded-name.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | expanded name.html | 2010-05-31 08:12 | 13K | |
![[TXT]](/icons/text.gif) | expanded qName.html | 2010-05-31 08:12 | 12K | |
![[TXT]](/icons/text.gif) | explicit expiration time.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | explicit user request.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | expression context.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | extended language.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | extended link.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | extended links.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | extending pre-defined elements.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | extensible.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | extensible markup language (XML).html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | extensible style language (XSL).html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | extension.html | 2010-05-31 08:12 | 16K | |
![[TXT]](/icons/text.gif) | extensional.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | extension attributes.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | extension expression.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | extension function.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | extension instruction.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | extension namespaces.html | 2010-05-31 08:12 | 9.9K | |
![[TXT]](/icons/text.gif) | external.html | 2010-05-31 08:12 | 14K | |
![[TXT]](/icons/text.gif) | external entity.html | 2010-05-31 08:12 | 10K | |
![[TXT]](/icons/text.gif) | external functions.html | 2010-05-31 08:12 | 9.7K | |
![[TXT]](/icons/text.gif) | externally-determined ID.html | 2010-05-31 08:12 | 9.8K | |
![[TXT]](/icons/text.gif) | external markup declaration.html | 2010-05-31 08:12 | 11K | |
![[TXT]](/icons/text.gif) | facet.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | facilities.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | fatal error.html | 2010-05-31 08:13 | 12K | |
![[TXT]](/icons/text.gif) | feature.html | 2010-05-31 08:13 | 18K | |
![[TXT]](/icons/text.gif) | fellow.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | fences.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | filter.html | 2010-05-31 08:13 | 12K | |
![[TXT]](/icons/text.gif) | filter expression.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | filtering.html | 2010-05-31 08:13 | 9.9K | |
![[TXT]](/icons/text.gif) | final output.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | final result tree.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | first-hand.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | first node rule.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | flexible authoring.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | focus, content focus, user interface focus,user .html | 2010-05-31 08:13 | 12K | |
![[TXT]](/icons/text.gif) | focus.html | 2010-05-31 08:13 | 15K | |
![[TXT]](/icons/text.gif) | focus of attention.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | following element.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | font-family.html | 2010-05-31 08:13 | 9.6K | |
![[TXT]](/icons/text.gif) | font-size.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | font-style.html | 2010-05-31 08:13 | 9.6K | |
![[TXT]](/icons/text.gif) | font-weight.html | 2010-05-31 08:13 | 9.6K | |
![[TXT]](/icons/text.gif) | font.html | 2010-05-31 08:13 | 12K | |
![[TXT]](/icons/text.gif) | for compatibility.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | for interoperability.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | form-2.html | 2010-05-31 08:13 | 24K | |
![[TXT]](/icons/text.gif) | form-4.html | 2010-05-31 08:13 | 15K | |
![[TXT]](/icons/text.gif) | form.html | 2010-05-31 08:13 | 25K | |
![[TXT]](/icons/text.gif) | formal.html | 2010-05-31 08:13 | 9.6K | |
![[TXT]](/icons/text.gif) | form control.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | form item.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | form item variable.html | 2010-05-31 08:13 | 9.9K | |
![[TXT]](/icons/text.gif) | forwards-compatible behavior.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | fragment.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | fragmentation.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | fragment identifier.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | frame buffer.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | fresh.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | freshness lifetime.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | full axis feature.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | functional adaptation.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | functional user experience.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | function conversion rules.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | function implementations.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | function parameter.html | 2010-05-31 08:13 | 9.9K | |
![[TXT]](/icons/text.gif) | function signatures..html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | gamma.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | gateway.html | 2010-05-31 08:13 | 16K | |
![[TXT]](/icons/text.gif) | general entities.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | generic identifier.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | global variable.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | glossary of terms for device independence (version used forDevice .html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | glyph.html | 2010-05-31 08:13 | 9.8K | |
![[TXT]](/icons/text.gif) | good practice.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | graphical.html | 2010-05-31 08:13 | 9.7K | |
![[TXT]](/icons/text.gif) | graphics.html | 2010-05-31 08:13 | 12K | |
![[TXT]](/icons/text.gif) | greyscale.html | 2010-05-31 08:13 | 10K | |
![[TXT]](/icons/text.gif) | grouping keys.html | 2010-05-31 08:13 | 9.9K | |
![[TXT]](/icons/text.gif) | group ruby.html | 2010-05-31 08:13 | 9.6K | |
![[TXT]](/icons/text.gif) | groups.html | 2010-05-31 08:13 | 11K | |
![[TXT]](/icons/text.gif) | harmonized adaptation.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | harmonized user experience.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | height.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | heuristic expiration time.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | highlight.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | hint.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | hiragana.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | host.html | 2010-05-31 08:14 | 12K | |
![[TXT]](/icons/text.gif) | host language.html | 2010-05-31 08:14 | 9.6K | |
![[TXT]](/icons/text.gif) | host page.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | hybrid document.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | hyperlink.html | 2010-05-31 08:14 | 9.6K | |
![[TXT]](/icons/text.gif) | hypermedia.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | hypertext.html | 2010-05-31 08:14 | 13K | |
![[TXT]](/icons/text.gif) | idempotent.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | identical.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | identified data.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | identifier.html | 2010-05-31 08:14 | 19K | |
![[TXT]](/icons/text.gif) | ideograph.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | iff.html | 2010-05-31 08:14 | 9.6K | |
![[TXT]](/icons/text.gif) | image.html | 2010-05-31 08:14 | 20K | |
![[TXT]](/icons/text.gif) | image data.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | image map.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | implementation-defined.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | implementation-dependent.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | implementation.html | 2010-05-31 08:14 | 20K | |
![[TXT]](/icons/text.gif) | implementation conformance statement (ICS).html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | implementation defined.html | 2010-05-31 08:14 | 12K | |
![[TXT]](/icons/text.gif) | implementation dependent.html | 2010-05-31 08:14 | 12K | |
![[TXT]](/icons/text.gif) | implementation platform.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | implicit timezone..html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | important.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | import precedence.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | imports closure.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | import tree.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | in-scope attribute declarations..html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | in-scope element declarations..html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | in-scope namespaces.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | in-scope schema components.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | in-scope schema definitions..html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | in-scope schema types..html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | in-scope variables..html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | inbound.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | included.html | 2010-05-31 08:14 | 12K | |
![[TXT]](/icons/text.gif) | included items.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | include location.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | include parent.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | inclusion target.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | incompletely validated.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | inconsistent.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | independent web .html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | index.html | 2010-05-31 08:14 | 13K | |
![[TXT]](/icons/text.gif) | indexed-colour.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | indexical.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | indexing.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | indirectly contained.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | individual-valued property.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | individual.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | infer.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | inferred mrow.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | inform.html | 2010-05-31 08:14 | 18K | |
![[TXT]](/icons/text.gif) | information resource.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | information set.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | information space.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | informative.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | initial SOAP sender.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | initial context node.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | initial item.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | initializing expression.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | initial sequence.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | initial template.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | input configuration.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | input item.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | input modalities.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | instance.html | 2010-05-31 08:14 | 15K | |
![[TXT]](/icons/text.gif) | instance data.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | instance data node.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | instance of.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | instance of mathML.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | instance of the data model.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | instantiate.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | instruction.html | 2010-05-31 08:14 | 12K | |
![[TXT]](/icons/text.gif) | integrity.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | intensional.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | interaction.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | interactive element, non-interactive element,non-interactive .html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | interlaced PNG image.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | internal.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | internal entity.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | internationalized resource identifier.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | internet.html | 2010-05-31 08:14 | 13K | |
![[TXT]](/icons/text.gif) | interoperability:.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | interpretation.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | intranet.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | intrinsic dimensions.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | inverse function.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | item.html | 2010-05-31 08:14 | 21K | |
![[TXT]](/icons/text.gif) | java.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | jigsaw.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | kana.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | kanji.html | 2010-05-31 08:14 | 9.6K | |
![[TXT]](/icons/text.gif) | katakana.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | keio university.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | key.html | 2010-05-31 08:14 | 22K | |
![[TXT]](/icons/text.gif) | key binding.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | key location.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | key management.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | key name.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | key specifier.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | key validation.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | kind test.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | lambda expression.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | language binding.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | language identifier.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | late normalization.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | layout schema (plural: schemata).html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | level.html | 2010-05-31 08:14 | 14K | |
![[TXT]](/icons/text.gif) | lexical qName.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | lexical space.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | library module.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | libwww.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | line-mode.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | line-mode browser.html | 2010-05-31 08:14 | 9.9K | |
![[TXT]](/icons/text.gif) | linearized table.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | link.html | 2010-05-31 08:14 | 21K | |
![[TXT]](/icons/text.gif) | linkbases.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | linking element.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | link text.html | 2010-05-31 08:14 | 9.6K | |
![[TXT]](/icons/text.gif) | list.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | literal.html | 2010-05-31 08:14 | 14K | |
![[TXT]](/icons/text.gif) | literal entity value.html | 2010-05-31 08:14 | 11K | |
![[TXT]](/icons/text.gif) | literal namespace URI.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | literal result element.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | live.html | 2010-05-31 08:14 | 15K | |
![[TXT]](/icons/text.gif) | local name.html | 2010-05-31 08:14 | 9.6K | |
![[TXT]](/icons/text.gif) | local part.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | local resource.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | local variable.html | 2010-05-31 08:14 | 9.7K | |
![[TXT]](/icons/text.gif) | logic.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | longfellow.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | loose coupling.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | lossless compression.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | lossy compression.html | 2010-05-31 08:14 | 9.8K | |
![[TXT]](/icons/text.gif) | luminance.html | 2010-05-31 08:14 | 10K | |
![[TXT]](/icons/text.gif) | name-2.html | 2010-05-31 08:15 | 23K | |
![[TXT]](/icons/text.gif) | name-4.html | 2010-05-31 08:15 | 22K | |
![[TXT]](/icons/text.gif) | name-6.html | 2010-05-31 08:15 | 14K | |
![[TXT]](/icons/text.gif) | name.html | 2010-05-31 08:15 | 23K | |
![[TXT]](/icons/text.gif) | named class.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | named template.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | name expression.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | namespace-2.html | 2010-05-31 08:15 | 20K | |
![[TXT]](/icons/text.gif) | namespace-sensitive.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | namespace-valid.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | namespace-validating.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | namespace-well-formed.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | namespace.html | 2010-05-31 08:15 | 24K | |
![[TXT]](/icons/text.gif) | namespace declaration.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | namespace declaration attribute.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | namespace document.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | namespace fixup.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | namespace name-2.html | 2010-05-31 08:15 | 20K | |
![[TXT]](/icons/text.gif) | namespace name.html | 2010-05-31 08:15 | 24K | |
![[TXT]](/icons/text.gif) | namespace prefix.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | name test.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | natural language.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | navigation.html | 2010-05-31 08:15 | 15K | |
![[TXT]](/icons/text.gif) | navigation bars.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | navigation mechanism.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | neXT.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | negotiate content.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | negotiation metadata.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | nelson, ted.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | net.html | 2010-05-31 08:15 | 17K | |
![[TXT]](/icons/text.gif) | network byte order.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | new.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | node-2.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | node.html | 2010-05-31 08:15 | 22K | |
![[TXT]](/icons/text.gif) | nodes.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | node test.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | non-recoverable dynamic error.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | non-repudiation.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | non-variant content.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | none.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | nonmonotonic.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | normative, informative.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | normative.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | notation declarations.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | notations.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | note.html | 2010-05-31 08:15 | 12K | |
![[TXT]](/icons/text.gif) | numeric predicate.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | object.html | 2010-05-31 08:15 | 17K | |
![[TXT]](/icons/text.gif) | object property.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | obligation.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | obsolete feature.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | occurs as attribute value.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | office.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | onLoad.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | onRequest.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | ontological.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | ontology.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | ontology document.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | openMath.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | open source.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | operating environment.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | operation.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | operator, an mo element.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | operator, content element.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | optional.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | optional axes.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | optional recovery action.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | option declaration.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | orchestration.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | ordering mode declaration.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | order of first appearance.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | origin server.html | 2010-05-31 08:15 | 12K | |
![[TXT]](/icons/text.gif) | other.html | 2010-05-31 08:15 | 11K | |
![[TXT]](/icons/text.gif) | otherwise.html | 2010-05-31 08:15 | 9.9K | |
![[TXT]](/icons/text.gif) | outbound.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | output definition.html | 2010-05-31 08:15 | 9.8K | |
![[TXT]](/icons/text.gif) | output modalities.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | output states.html | 2010-05-31 08:15 | 9.7K | |
![[TXT]](/icons/text.gif) | override.html | 2010-05-31 08:15 | 10K | |
![[TXT]](/icons/text.gif) | packet.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | page view.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | palette.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | perceivable unit.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | permission.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | permission guard.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | personal digital assistant (PDA).html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | person or organization.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | physical transducer.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | picture string.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | pixel.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | placeholder.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | place marker.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | plug-in.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | point.html | 2010-05-31 08:18 | 16K | |
![[TXT]](/icons/text.gif) | pointer.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | pointer part.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | point of regard.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | policy.html | 2010-05-31 08:18 | 16K | |
![[TXT]](/icons/text.gif) | policy guard.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | practice.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | pre-defined function.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | preceding element.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | predefined entity reference.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | predicate.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | preference.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | presentation elements.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | presentation layout schema.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | presentation markup.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | presentation token element.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | preserve.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | primary expressions.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | primitive simple types.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | principal.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | principal node kind.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | principal node type.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | principal stylesheet module.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | principle.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | priority 1 (P1).html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | priority 2 (P2).html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | priority 3 (P3).html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | privacy.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | privacy policy.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | process.html | 2010-05-31 08:18 | 21K | |
![[TXT]](/icons/text.gif) | processing instructions.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | processing order.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | processor.html | 2010-05-31 08:18 | 17K | |
![[TXT]](/icons/text.gif) | profile.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | prompt.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | proof ofof possession (POP).html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | properties, values, and defaults.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | property.html | 2010-05-31 08:18 | 15K | |
![[TXT]](/icons/text.gif) | property definition.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | proposition.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | protection.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | protocol.html | 2010-05-31 08:18 | 14K | |
![[TXT]](/icons/text.gif) | provider agent.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | provider entity.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | proximity position.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | proxy.html | 2010-05-31 08:18 | 18K | |
![[TXT]](/icons/text.gif) | public identifier.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | publish.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | publisher.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | purpose.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | qName.html | 2010-05-31 08:17 | 15K | |
![[TXT]](/icons/text.gif) | qualified name.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | qualified names.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | qualifier.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | quality assurance, QA.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | quality of service.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | reader.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | reading.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | receiver.html | 2010-05-31 08:17 | 14K | |
![[TXT]](/icons/text.gif) | recognize.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | recommendation.html | 2010-05-31 08:17 | 14K | |
![[TXT]](/icons/text.gif) | recoverable errors.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | reduced image.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | reference architecture.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | reference image.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | reference in DTD.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | reference in attribute value.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | reference in content.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | reference in entity value.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | registry.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | reify.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | relation.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | remote resource.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | render.html | 2010-05-31 08:17 | 16K | |
![[TXT]](/icons/text.gif) | rendered content, rendered text.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | rendered content.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | rendering.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | rendering preferences.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | repair content, repair text.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | replace.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | replaced element.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | replacement text.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | repository.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | representation.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | request.html | 2010-05-31 08:17 | 23K | |
![[TXT]](/icons/text.gif) | requester agent.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | requester entity.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | required type.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | reserved.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | reserved namespaces.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | resource-2.html | 2010-05-31 08:17 | 18K | |
![[TXT]](/icons/text.gif) | resource.html | 2010-05-31 08:17 | 25K | |
![[TXT]](/icons/text.gif) | resource error.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | resource manifestation.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | response.html | 2010-05-31 08:17 | 14K | |
![[TXT]](/icons/text.gif) | restriction, global.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | restriction, local.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | restriction.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | result infoset.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | reverse document order.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | root.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | ruby text.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | safe.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | safe interaction.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | safe zone.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | sample.html | 2010-05-31 08:17 | 14K | |
![[TXT]](/icons/text.gif) | sample depth.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | sample depth scaling.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | satisfy.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | scanline.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | schema (pl., schemata).html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | schema, RDF schema.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | schema-2.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | schema-aware XSLT processor.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | schema-determined ID.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | schema.html | 2010-05-31 08:17 | 23K | |
![[TXT]](/icons/text.gif) | schema components.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | schema constraint.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | schema import.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | schema import feature.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | schema instance namespace.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | schema namespace.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | schema representation constraint.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | schema type.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | schema validation feature.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | scheme.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | scope of a declaration.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | screen magnifier.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | screen reader.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | scribe.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | script.html | 2010-05-31 08:17 | 22K | |
![[TXT]](/icons/text.gif) | secondary resource.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | security.html | 2010-05-31 08:17 | 21K | |
![[TXT]](/icons/text.gif) | security administration.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | security architecture.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | security auditing.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | security domain.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | security mechanism.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | security model.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | security policy.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | security policy expression.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | security service.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | selected.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | selected sub-expression (of an maction element).html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | selection, current selection.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | semantic.html | 2010-05-31 08:17 | 15K | |
![[TXT]](/icons/text.gif) | semantically transparent.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | semantic requirement.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | semantic web.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | sender.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | separation of form from content.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | sequence.html | 2010-05-31 08:17 | 18K | |
![[TXT]](/icons/text.gif) | sequenceType matching.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | sequence constructor.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | sequence type.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | serial access, sequential navigation.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | serialization.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | serialization error.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | serialization feature.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | server.html | 2010-05-31 08:17 | 20K | |
![[TXT]](/icons/text.gif) | server session.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | service-oriented architecture.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | service.html | 2010-05-31 08:17 | 30K | |
![[TXT]](/icons/text.gif) | service description.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | service interface.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | service intermediary.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | service provider (Data controller, legal entity).html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | service provider.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | service requester.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | service role.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | service semantics.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | session.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | set.html | 2010-05-31 08:17 | 18K | |
![[TXT]](/icons/text.gif) | setters.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | shall.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | should.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | sibling.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | simple link.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | simple links.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | simple ruby markup.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | simplified stylesheet module.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | single authoring.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | singleton.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | singleton focus.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | site maps.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | size and color of non-text content.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | sophia.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | sorted sequence.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | sort key component.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | sort key specification.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | sort key value.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | source document.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | source image.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | source infoset.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | space-like (MathML expression).html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | specification.html | 2010-05-31 08:17 | 14K | |
![[TXT]](/icons/text.gif) | speech.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | speech synthesis.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | stable.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | stale.html | 2010-05-31 08:17 | 9.6K | |
![[TXT]](/icons/text.gif) | standalone stylesheet module.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | standard.html | 2010-05-31 08:17 | 14K | |
![[TXT]](/icons/text.gif) | standard attributes.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | standard function namespace.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | standard generalized markup language (SGML).html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | standard stylesheet module.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | start-tag.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | starting resource.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | statement.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | statically known collations..html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | statically known collections..html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | statically known default collection type..html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | statically known documents..html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | statically known namespaces..html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | static analysis phase.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | static context.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | static error.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | static type.html | 2010-05-31 08:17 | 13K | |
![[TXT]](/icons/text.gif) | static typing extension.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | static typing feature.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | step.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | strict conformance.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | string-value.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | string identity matching.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | string indexing.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | string value.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | structural markup.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | style sheet.html | 2010-05-31 08:17 | 24K | |
![[TXT]](/icons/text.gif) | stylesheet.html | 2010-05-31 08:17 | 16K | |
![[TXT]](/icons/text.gif) | stylesheet function.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | stylesheet level.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | stylesheet modules.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | stylesheet parameter.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | style sheets.html | 2010-05-31 08:17 | 12K | |
![[TXT]](/icons/text.gif) | sub-expression (of a mathML expression(of .html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | subdialog.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | submission.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | subset language.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | subsite.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | substitution groups.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | subtype substitution.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | suggested rendering rules for mathML presentation elements.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | supersite.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | support, implement, conform.html | 2010-05-31 08:17 | 10K | |
![[TXT]](/icons/text.gif) | supported.html | 2010-05-31 08:17 | 9.8K | |
![[TXT]](/icons/text.gif) | synchronize.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | synthesis processor.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | sysWeb.html | 2010-05-31 08:17 | 9.7K | |
![[TXT]](/icons/text.gif) | system entity.html | 2010-05-31 08:17 | 9.9K | |
![[TXT]](/icons/text.gif) | system identifier.html | 2010-05-31 08:17 | 11K | |
![[TXT]](/icons/text.gif) | tables of contents.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | tabular information.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | tag.html | 2010-05-31 08:18 | 14K | |
![[TXT]](/icons/text.gif) | tangle.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | tapered prompts.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | target namespace.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | target namespace URI.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | team.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | technical architecture group.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | technical report.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | term taken verbatim from another source.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | testability.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | test assertion.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | test case.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | test purpose.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | test requirement.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | test suite.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | text-2.html | 2010-05-31 08:18 | 26K | |
![[TXT]](/icons/text.gif) | text-To-Speech.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | text.html | 2010-05-31 08:18 | 22K | |
![[TXT]](/icons/text.gif) | text content, non-text content,non-text .html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | text decoration.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | text transcript.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | the empty string.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | third-party.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | throw.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | time parameters.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | tobin.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | token.html | 2010-05-31 08:18 | 14K | |
![[TXT]](/icons/text.gif) | token element.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | tokenized.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | top-level.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | top-level element (of mathML).html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | top-level included items.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | topology.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | tracing.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | transcript.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | transformation.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | traversal.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | triple.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | truecolour.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | trust service.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | tunnel.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | tunnel parameter.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | type-2.html | 2010-05-31 08:18 | 24K | |
![[TXT]](/icons/text.gif) | type-4.html | 2010-05-31 08:18 | 17K | |
![[TXT]](/icons/text.gif) | type.html | 2010-05-31 08:18 | 25K | |
![[TXT]](/icons/text.gif) | type annotation.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | type error.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | type errors.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | typeface.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | uRIs.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | ultimate SOAP receiver.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | uniform resource identifier (URI).html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | uniform resource identifier.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | union.html | 2010-05-31 08:18 | 9.6K | |
![[TXT]](/icons/text.gif) | universe.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | unnamed class.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | unparsed entity.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | unsafe interaction.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | unspecified.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | usage auditing.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | use-2.html | 2010-05-31 08:18 | 24K | |
![[TXT]](/icons/text.gif) | use.html | 2010-05-31 08:18 | 28K | |
![[TXT]](/icons/text.gif) | user-2.html | 2010-05-31 08:18 | 20K | |
![[TXT]](/icons/text.gif) | user-defined data elements.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | user-defined function.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | user.html | 2010-05-31 08:18 | 29K | |
![[TXT]](/icons/text.gif) | user agent (UA).html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | user agent.html | 2010-05-31 08:18 | 19K | |
![[TXT]](/icons/text.gif) | user agent default styles.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | user agent profile.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | user control of every user interface component.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | user experience.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | user experience preferences.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | user interface, user interface, .html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | user session.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | user styles.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | valid.html | 2010-05-31 08:18 | 23K | |
![[TXT]](/icons/text.gif) | validating processors.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | validation, validate, validating.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | validation.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | validation rule.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | validator.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | validity constraint.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | valid mathML data.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | valid style sheet.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | value space.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | variable-binding elements.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | variant.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | variant content.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | version declaration.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | versioning.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | video.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | view, viewport.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | view.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | virtual hypertext.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | visual-only presentation.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | visualText.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | visual track.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | vocabulary.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | voice.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | voiceXML document.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | voiceXML interpreter.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | voiceXML interpreter context.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | voice browser.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | web-2.html | 2010-05-31 08:18 | 23K | |
![[TXT]](/icons/text.gif) | web.html | 2010-05-31 08:18 | 27K | |
![[TXT]](/icons/text.gif) | web agent.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | web client.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | web collection.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | web core.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | web neighborhood .html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | web neighborhood.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | web page.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | web page identifier.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | web periphery.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | web request.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | web request body.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | web request header.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | web resource .html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | web resource.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | web response.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | web response body.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | web response header.html | 2010-05-31 08:18 | 9.9K | |
![[TXT]](/icons/text.gif) | web server.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | web service.html | 2010-05-31 08:18 | 11K | |
![[TXT]](/icons/text.gif) | web site.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | web site publisher.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | well-formed.html | 2010-05-31 08:18 | 14K | |
![[TXT]](/icons/text.gif) | well-formedness constraint.html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | white point.html | 2010-05-31 08:18 | 9.8K | |
![[TXT]](/icons/text.gif) | whitespace text node.html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | width (of a box).html | 2010-05-31 08:18 | 9.7K | |
![[TXT]](/icons/text.gif) | world.html | 2010-05-31 08:18 | 13K | |
![[TXT]](/icons/text.gif) | worldWideWeb (one word; no spaces).html | 2010-05-31 08:18 | 10K | |
![[TXT]](/icons/text.gif) | world wide web.html | 2010-05-31 08:18 | 12K | |
![[TXT]](/icons/text.gif) | xForms model.html | 2010-05-31 08:19 | 9.7K | |
![[TXT]](/icons/text.gif) | xForms processor.html | 2010-05-31 08:19 | 9.7K | |
![[TXT]](/icons/text.gif) | xML-based format.html | 2010-05-31 08:19 | 9.7K | |
![[TXT]](/icons/text.gif) | xPath 1.0 compatibility mode..html | 2010-05-31 08:19 | 11K | |
![[TXT]](/icons/text.gif) | xPath 1.0 compatibility mode.html | 2010-05-31 08:19 | 11K | |
![[TXT]](/icons/text.gif) | xPath expression.html | 2010-05-31 08:19 | 9.7K | |
![[TXT]](/icons/text.gif) | xPointer processor.html | 2010-05-31 08:19 | 9.8K | |
![[TXT]](/icons/text.gif) | zakim.html | 2010-05-31 08:19 | 9.8K | |
![[TXT]](/icons/text.gif) | zlib.html | 2010-05-31 08:19 | 10K | |
|